* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BZ 0301 |
English Synonyms: | RARECHEM AL BZ 0301 |
MDL Number.: | MFCD06216425 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | CC(Cc1ccc(cc1)C(C)(C)C)C(CC(=O)N)N |
InChi: | InChI=1S/C16H26N2O/c1-11(14(17)10-15(18)19)9-12-5-7-13(8-6-12)16(2,3)4/h5-8,11,14H,9-10,17H2,1-4H3,(H2,18,19) |
InChiKey: | InChIKey=IZLQKYOBMXJWOW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.