* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BZ 0350 |
English Synonyms: | RARECHEM AL BZ 0350 |
MDL Number.: | MFCD06216466 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | c1ccc(cc1)C#Cc2ccc(s2)C(CC(=O)N)N |
InChi: | InChI=1S/C15H14N2OS/c16-13(10-15(17)18)14-9-8-12(19-14)7-6-11-4-2-1-3-5-11/h1-5,8-9,13H,10,16H2,(H2,17,18) |
InChiKey: | InChIKey=OEWCOOFEYYWNCO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.