* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AL BZ 0417 |
| English Synonyms: | RARECHEM AL BZ 0417 |
| MDL Number.: | MFCD06216514 |
| H bond acceptor: | 5 |
| H bond donor: | 3 |
| Smile: | c1ccc(cc1)c2c(c[nH]n2)C(CC(=O)N)N |
| InChi: | InChI=1S/C12H14N4O/c13-10(6-11(14)17)9-7-15-16-12(9)8-4-2-1-3-5-8/h1-5,7,10H,6,13H2,(H2,14,17)(H,15,16) |
| InChiKey: | InChIKey=JYARBPTXCLHTEV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.