* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BZ 0421 |
English Synonyms: | RARECHEM AL BZ 0421 |
MDL Number.: | MFCD06216518 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | c1ccc(c(c1)C(CC(=O)N)N)OCCO |
InChi: | InChI=1S/C11H16N2O3/c12-9(7-11(13)15)8-3-1-2-4-10(8)16-6-5-14/h1-4,9,14H,5-7,12H2,(H2,13,15) |
InChiKey: | InChIKey=FBBBCCBXTGNEEM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.