* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BZ 0423 |
English Synonyms: | RARECHEM AL BZ 0423 |
MDL Number.: | MFCD06216520 |
H bond acceptor: | 7 |
H bond donor: | 4 |
Smile: | c1ccc(c(c1)C(CC(=O)N)N)Oc2ccccc2C(CC(=O)N)N |
InChi: | InChI=1S/C18H22N4O3/c19-13(9-17(21)23)11-5-1-3-7-15(11)25-16-8-4-2-6-12(16)14(20)10-18(22)24/h1-8,13-14H,9-10,19-20H2,(H2,21,23)(H2,22,24) |
InChiKey: | InChIKey=ZTGMFWJSUBJTBC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.