* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AL BZ 0522 |
| English Synonyms: | RARECHEM AL BZ 0522 |
| MDL Number.: | MFCD06216616 |
| H bond acceptor: | 4 |
| H bond donor: | 2 |
| Smile: | Cc1cc(c(cc1OC)C)C(CC(=O)N)N |
| InChi: | InChI=1S/C12H18N2O2/c1-7-5-11(16-3)8(2)4-9(7)10(13)6-12(14)15/h4-5,10H,6,13H2,1-3H3,(H2,14,15) |
| InChiKey: | InChIKey=HMIUCHMBZMXYLH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.