* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BZ 1076 |
English Synonyms: | RARECHEM AL BZ 1076 |
MDL Number.: | MFCD06217091 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | CCOC(=O)C1CCN(CC1)c2ccccc2C(CC(=O)N)N |
InChi: | InChI=1S/C17H25N3O3/c1-2-23-17(22)12-7-9-20(10-8-12)15-6-4-3-5-13(15)14(18)11-16(19)21/h3-6,12,14H,2,7-11,18H2,1H3,(H2,19,21) |
InChiKey: | InChIKey=FIKICONQJCLPPA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.