* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BZ 1094 |
English Synonyms: | RARECHEM AL BZ 1094 |
MDL Number.: | MFCD06217107 |
H bond acceptor: | 7 |
H bond donor: | 3 |
Smile: | c1ccc(c(c1)/C(=C/O)/C(CC(=O)N)N)[N+](=O)[O-] |
InChi: | InChI=1S/C11H13N3O4/c12-9(5-11(13)16)8(6-15)7-3-1-2-4-10(7)14(17)18/h1-4,6,9,15H,5,12H2,(H2,13,16)/b8-6- |
InChiKey: | InChIKey=HSTSPGVRMSNVHS-VURMDHGXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.