* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AL BZ 1095 |
| English Synonyms: | RARECHEM AL BZ 1095 |
| MDL Number.: | MFCD06217108 |
| H bond acceptor: | 9 |
| H bond donor: | 4 |
| Smile: | c1cc(c(c(c1)C(=O)N)[N+](=O)[O-])/C(=C/O)/C(CC(=O)N)N |
| InChi: | InChI=1S/C12H14N4O5/c13-9(4-10(14)18)8(5-17)6-2-1-3-7(12(15)19)11(6)16(20)21/h1-3,5,9,17H,4,13H2,(H2,14,18)(H2,15,19)/b8-5- |
| InChiKey: | InChIKey=NXPGEYICSDSUSG-YVMONPNESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.