* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BZ 1102 |
English Synonyms: | RARECHEM AL BZ 1102 |
MDL Number.: | MFCD06217114 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | COc1ccc(cc1)/C(=C(/c2ccc(cc2)OC)\Cl)/C(CC(=O)N)N |
InChi: | InChI=1S/C19H21ClN2O3/c1-24-14-7-3-12(4-8-14)18(16(21)11-17(22)23)19(20)13-5-9-15(25-2)10-6-13/h3-10,16H,11,21H2,1-2H3,(H2,22,23)/b19-18+ |
InChiKey: | InChIKey=OQMJRMRIKAXNDV-VHEBQXMUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.