* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BZ 1112 |
English Synonyms: | RARECHEM AL BZ 1112 |
MDL Number.: | MFCD06217123 |
H bond acceptor: | 9 |
H bond donor: | 3 |
Smile: | c1ccc(cc1)CC(=O)NC2C3N(C2=O)C(=C(CS3)C(CC(=O)N)N)C(=O)OC(c4ccccc4)c5ccccc5 |
InChi: | InChI=1S/C31H30N4O5S/c32-23(17-24(33)36)22-18-41-30-26(34-25(37)16-19-10-4-1-5-11-19)29(38)35(30)27(22)31(39)40-28(20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1-15,23,26,28,30H,16-18,32H2,(H2,33,36)(H,34,37) |
InChiKey: | InChIKey=JEJCMMBPUKYANT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.