* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AL BZ 1117 |
| English Synonyms: | RARECHEM AL BZ 1117 |
| MDL Number.: | MFCD06217128 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | CN(C)/C=C(\C(CC(=O)N)N)/Oc1c(cccc1Cl)Cl |
| InChi: | InChI=1S/C13H17Cl2N3O2/c1-18(2)7-11(10(16)6-12(17)19)20-13-8(14)4-3-5-9(13)15/h3-5,7,10H,6,16H2,1-2H3,(H2,17,19)/b11-7+ |
| InChiKey: | InChIKey=WBOHLTKCPNRIIW-YRNVUSSQSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.