* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BZ 1121 |
English Synonyms: | RARECHEM AL BZ 1121 |
MDL Number.: | MFCD06217132 |
H bond acceptor: | 8 |
H bond donor: | 3 |
Smile: | COc1ccc(c(c1)/C(=C/O)/C(CC(=O)N)N)[N+](=O)[O-].O |
InChi: | InChI=1S/C12H15N3O5.H2O/c1-20-7-2-3-11(15(18)19)8(4-7)9(6-16)10(13)5-12(14)17;/h2-4,6,10,16H,5,13H2,1H3,(H2,14,17);1H2/b9-6-; |
InChiKey: | InChIKey=HRJGMQHPUPCRDG-BORNJIKYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.