* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BZ 1131 |
English Synonyms: | RARECHEM AL BZ 1131 |
MDL Number.: | MFCD06217141 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | Cc1ccc(cc1)n2cccc2C(CC(=O)N)N |
InChi: | InChI=1S/C14H17N3O/c1-10-4-6-11(7-5-10)17-8-2-3-13(17)12(15)9-14(16)18/h2-8,12H,9,15H2,1H3,(H2,16,18) |
InChiKey: | InChIKey=DGHCWOPZXJOWOK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.