* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BZ 1133 |
English Synonyms: | RARECHEM AL BZ 1133 |
MDL Number.: | MFCD06217143 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | c1cc2cc(c(=O)n3c2c(c1)CC3)C(CC(=O)N)N |
InChi: | InChI=1S/C14H15N3O2/c15-11(7-12(16)18)10-6-9-3-1-2-8-4-5-17(13(8)9)14(10)19/h1-3,6,11H,4-5,7,15H2,(H2,16,18) |
InChiKey: | InChIKey=SELBEGKHFDIZJC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.