* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BZ 1134 |
English Synonyms: | RARECHEM AL BZ 1134 |
MDL Number.: | MFCD06217144 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | c1cc2cc(c(=O)n3c2c(c1)CCC3)C(CC(=O)N)N |
InChi: | InChI=1S/C15H17N3O2/c16-12(8-13(17)19)11-7-10-4-1-3-9-5-2-6-18(14(9)10)15(11)20/h1,3-4,7,12H,2,5-6,8,16H2,(H2,17,19) |
InChiKey: | InChIKey=DUIWZLHYEKUJIV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.