* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AL BZ 1140 |
| English Synonyms: | RARECHEM AL BZ 1140 |
| MDL Number.: | MFCD06217150 |
| H bond acceptor: | 8 |
| H bond donor: | 2 |
| Smile: | CC(=O)Oc1cc(cc(c1OC(=O)C)OC)C(CC(=O)N)N |
| InChi: | InChI=1S/C14H18N2O6/c1-7(17)21-12-5-9(10(15)6-13(16)19)4-11(20-3)14(12)22-8(2)18/h4-5,10H,6,15H2,1-3H3,(H2,16,19) |
| InChiKey: | InChIKey=XVYSIPVLQCASMQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.