* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BZ 1150 |
English Synonyms: | RARECHEM AL BZ 1150 |
MDL Number.: | MFCD06217160 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | CCCCCc1ccc(cc1)C(=O)c2cc3cc(ccc3o2)C(CC(=O)N)N |
InChi: | InChI=1S/C23H26N2O3/c1-2-3-4-5-15-6-8-16(9-7-15)23(27)21-13-18-12-17(10-11-20(18)28-21)19(24)14-22(25)26/h6-13,19H,2-5,14,24H2,1H3,(H2,25,26) |
InChiKey: | InChIKey=LZRWFIMLNJVDSW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.