* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AL BZ 1159 |
| English Synonyms: | RARECHEM AL BZ 1159 |
| MDL Number.: | MFCD06217168 |
| H bond acceptor: | 10 |
| H bond donor: | 7 |
| Smile: | c1c(cc(c(c1C(CC(=O)N)N)O)C(CC(=O)N)N)C(CC(=O)N)N |
| InChi: | InChI=1S/C15H24N6O4/c16-9(3-12(19)22)6-1-7(10(17)4-13(20)23)15(25)8(2-6)11(18)5-14(21)24/h1-2,9-11,25H,3-5,16-18H2,(H2,19,22)(H2,20,23)(H2,21,24) |
| InChiKey: | InChIKey=OVXMRYIVTOSNCI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.