* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AL BZ 1190 |
| English Synonyms: | RARECHEM AL BZ 1190 |
| MDL Number.: | MFCD06217197 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | CCOC(=O)c1c2c(c(s1)SC)C(=C(CC2)C(CC(=O)N)N)Cl |
| InChi: | InChI=1S/C15H19ClN2O3S2/c1-3-21-14(20)13-8-5-4-7(9(17)6-10(18)19)12(16)11(8)15(22-2)23-13/h9H,3-6,17H2,1-2H3,(H2,18,19) |
| InChiKey: | InChIKey=TWQQIGUGPMGQKT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.