* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BZ 1218 |
English Synonyms: | RARECHEM AL BZ 1218 |
MDL Number.: | MFCD06217224 |
H bond acceptor: | 9 |
H bond donor: | 5 |
Smile: | COc1cc(c(c(c1C(CC(=O)N)N)O)C(CC(=O)N)N)OC |
InChi: | InChI=1S/C14H22N4O5/c1-22-8-5-9(23-2)13(7(16)4-11(18)20)14(21)12(8)6(15)3-10(17)19/h5-7,21H,3-4,15-16H2,1-2H3,(H2,17,19)(H2,18,20) |
InChiKey: | InChIKey=JIOFBXARVQXTEC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.