* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BZ 1222 |
English Synonyms: | RARECHEM AL BZ 1222 |
MDL Number.: | MFCD06217228 |
H bond acceptor: | 6 |
H bond donor: | 4 |
Smile: | c1cc(cc(c1)Cl)C(C(CC(=O)N)N)C(CC(=O)N)N |
InChi: | InChI=1S/C13H19ClN4O2/c14-8-3-1-2-7(4-8)13(9(15)5-11(17)19)10(16)6-12(18)20/h1-4,9-10,13H,5-6,15-16H2,(H2,17,19)(H2,18,20) |
InChiKey: | InChIKey=PSIHDBREQNCGBV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.