* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AL BZ 1259 |
| English Synonyms: | RARECHEM AL BZ 1259 |
| MDL Number.: | MFCD06217264 |
| H bond acceptor: | 5 |
| H bond donor: | 2 |
| Smile: | Cn1c(c(c(n1)C(F)(F)F)C(CC(=O)N)N)Sc2ccc(cc2)Br |
| InChi: | InChI=1S/C14H14BrF3N4OS/c1-22-13(24-8-4-2-7(15)3-5-8)11(9(19)6-10(20)23)12(21-22)14(16,17)18/h2-5,9H,6,19H2,1H3,(H2,20,23) |
| InChiKey: | InChIKey=BHUNFIUBZVKMAP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.