* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BZ 1283 |
English Synonyms: | RARECHEM AL BZ 1283 |
MDL Number.: | MFCD06217288 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | c1c(c(c(c(c1Cl)F)F)C(CC(=O)N)N)F |
InChi: | InChI=1S/C9H8ClF3N2O/c10-3-1-4(11)7(9(13)8(3)12)5(14)2-6(15)16/h1,5H,2,14H2,(H2,15,16) |
InChiKey: | InChIKey=ZVJFQDRBHUBRMM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.