* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL BZ 1284 |
English Synonyms: | RARECHEM AL BZ 1284 |
MDL Number.: | MFCD06217289 |
H bond acceptor: | 7 |
H bond donor: | 4 |
Smile: | c1c([nH]c(=O)[nH]c1=O)C(CC(=O)N)N.O |
InChi: | InChI=1S/C7H10N4O3.H2O/c8-3(1-5(9)12)4-2-6(13)11-7(14)10-4;/h2-3H,1,8H2,(H2,9,12)(H2,10,11,13,14);1H2 |
InChiKey: | InChIKey=RCWQNQOOMVUQAD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.