* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AL BZ 1306 |
| English Synonyms: | RARECHEM AL BZ 1306 |
| MDL Number.: | MFCD06217311 |
| H bond acceptor: | 6 |
| H bond donor: | 4 |
| Smile: | c1c(cc(cc1F)F)C(C(CC(=O)N)N)C(CC(=O)N)N |
| InChi: | InChI=1S/C13H18F2N4O2/c14-7-1-6(2-8(15)3-7)13(9(16)4-11(18)20)10(17)5-12(19)21/h1-3,9-10,13H,4-5,16-17H2,(H2,18,20)(H2,19,21) |
| InChiKey: | InChIKey=HKDYWOBEMYNSLM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.