* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AL F1 2003 |
| English Synonyms: | RARECHEM AL F1 2003 |
| MDL Number.: | MFCD06227413 |
| H bond acceptor: | 8 |
| H bond donor: | 1 |
| Smile: | C/C(=C/c1nnnn1c2ccc(cc2)OC)/Nc3cc(on3)C(C)(C)C |
| InChi: | InChI=1S/C18H22N6O2/c1-12(19-16-11-15(26-21-16)18(2,3)4)10-17-20-22-23-24(17)13-6-8-14(25-5)9-7-13/h6-11H,1-5H3,(H,19,21)/b12-10- |
| InChiKey: | InChIKey=OEQVEGWQSUURSB-BENRWUELSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.