* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL F1 2054 |
English Synonyms: | RARECHEM AL F1 2054 |
MDL Number.: | MFCD06227426 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | C/C(=C/C(=O)c1ccc2ccccc2c1)/Nc3ccc(cc3)Cl |
InChi: | InChI=1S/C20H16ClNO/c1-14(22-19-10-8-18(21)9-11-19)12-20(23)17-7-6-15-4-2-3-5-16(15)13-17/h2-13,22H,1H3/b14-12- |
InChiKey: | InChIKey=QTIBGOKOXZIMDZ-OWBHPGMISA-N |
* If the product has intellectual property rights, a license granted is must or contact us.