* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL F1 2056 |
English Synonyms: | RARECHEM AL F1 2056 |
MDL Number.: | MFCD06227428 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | C/C(=C/c1nnnn1c2ccc(cc2)Cl)/Nc3cccc(c3)C(=O)C |
InChi: | InChI=1S/C18H16ClN5O/c1-12(20-16-5-3-4-14(11-16)13(2)25)10-18-21-22-23-24(18)17-8-6-15(19)7-9-17/h3-11,20H,1-2H3/b12-10- |
InChiKey: | InChIKey=JLERUXIORKGZOO-BENRWUELSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.