* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AL F1 2095 |
English Synonyms: | RARECHEM AL F1 2095 |
MDL Number.: | MFCD06227434 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CCc1ccc(cc1)C(=O)/C=C(/C)\Nc2cc(no2)C |
InChi: | InChI=1S/C16H18N2O2/c1-4-13-5-7-14(8-6-13)15(19)9-11(2)17-16-10-12(3)18-20-16/h5-10,17H,4H2,1-3H3/b11-9- |
InChiKey: | InChIKey=VFVDMOLMNDIKFD-LUAWRHEFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.