* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AM LA 0055 |
| English Synonyms: | RARECHEM AM LA 0055 |
| MDL Number.: | MFCD06227462 |
| H bond acceptor: | 5 |
| H bond donor: | 4 |
| Smile: | CC(C(c1ccc(c(c1)O)O)N)C(=O)O |
| InChi: | InChI=1S/C10H13NO4/c1-5(10(14)15)9(11)6-2-3-7(12)8(13)4-6/h2-5,9,12-13H,11H2,1H3,(H,14,15) |
| InChiKey: | InChIKey=GRSMFKDPNFGMBT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.