* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AQ A1 0005 |
English Synonyms: | RARECHEM AQ A1 0005 |
MDL Number.: | MFCD06227534 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CC[C@H](C)/C(=C(/c1ccccc1)\c2ccccc2C)/Cl |
InChi: | InChI=1S/C19H21Cl/c1-4-14(2)19(20)18(16-11-6-5-7-12-16)17-13-9-8-10-15(17)3/h5-14H,4H2,1-3H3/b19-18+/t14-/m0/s1 |
InChiKey: | InChIKey=LJGGZPXHAHMXSQ-HLAUDOPJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.