* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AQ BC 8008 |
| English Synonyms: | RARECHEM AQ BC 8008 |
| MDL Number.: | MFCD06227542 |
| H bond acceptor: | 2 |
| H bond donor: | 2 |
| Smile: | c1ccc(cc1)[C@]2(CC[C@H]3[C@@H]2CC[C@@]3(c4ccccc4)O)O |
| InChi: | InChI=1S/C20H22O2/c21-19(15-7-3-1-4-8-15)13-11-18-17(19)12-14-20(18,22)16-9-5-2-6-10-16/h1-10,17-18,21-22H,11-14H2/t17-,18-,19-,20-/m0/s1 |
| InChiKey: | InChIKey=BGPALYKOUQFTBY-MUGJNUQGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.