* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AQ BC 8011 |
English Synonyms: | RARECHEM AQ BC 8011 |
MDL Number.: | MFCD06227543 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | c1ccc(cc1)[C@H]2CC(=O)[C@H]3[C@@H]2C(=O)C[C@@H]3c4ccccc4 |
InChi: | InChI=1S/C20H18O2/c21-17-11-15(13-7-3-1-4-8-13)19-18(22)12-16(20(17)19)14-9-5-2-6-10-14/h1-10,15-16,19-20H,11-12H2/t15-,16-,19+,20+/m1/s1 |
InChiKey: | InChIKey=OUJHJNVXVVZYPB-YKCBXCCJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.