* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AQ BC 8015 |
| English Synonyms: | RARECHEM AQ BC 8015 |
| MDL Number.: | MFCD06227547 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | c1ccc(cc1)[C@@H]2CC(=O)[C@@H]3[C@H]2C(=C[C@H]3c4ccccc4)c5ccccc5 |
| InChi: | InChI=1S/C26H22O/c27-24-17-23(20-14-8-3-9-15-20)25-21(18-10-4-1-5-11-18)16-22(26(24)25)19-12-6-2-7-13-19/h1-16,22-23,25-26H,17H2/t22-,23-,25-,26+/m0/s1 |
| InChiKey: | InChIKey=MCMFCXUGJOXKJE-NLJWQWLVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.