* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AQ BC 8016 |
English Synonyms: | RARECHEM AQ BC 8016 |
MDL Number.: | MFCD06227548 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | COC(=O)C1=C[C@H]([C@H]2[C@@H]1[C@@H](C=C2C(=O)OC)Br)Br |
InChi: | InChI=1S/C12H12Br2O4/c1-17-11(15)5-3-7(13)10-6(12(16)18-2)4-8(14)9(5)10/h3-4,7-10H,1-2H3/t7-,8-,9+,10+/m1/s1 |
InChiKey: | InChIKey=NUTBFPZZYSOOAM-IMSYWVGJSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.