* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AQ BC 8040 |
English Synonyms: | RARECHEM AQ BC 8040 |
MDL Number.: | MFCD06227551 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | C[C@@]12CC=C[C@@]1(C(=O)C[C@H]2C#N)C.C[C@]12CC=C[C@]1([C@@H](CC2=O)C#N)C |
InChi: | InChI=1S/2C11H13NO/c2*1-10-4-3-5-11(10,2)9(13)6-8(10)7-12/h3,5,8H,4,6H2,1-2H3;3-4,8H,5-6H2,1-2H3/t2*8-,10-,11+/m00/s1 |
InChiKey: | InChIKey=DQIJTAFNFDRJHV-HYRNPZIGSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.