* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AQ BC 8075 |
| English Synonyms: | RARECHEM AQ BC 8075 |
| MDL Number.: | MFCD06227559 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | C[C@]12CC[C@@]([C@]1(CCC2=O)C)(C#Cc3ccccc3)O |
| InChi: | InChI=1S/C18H20O2/c1-16-12-13-18(20,17(16,2)10-9-15(16)19)11-8-14-6-4-3-5-7-14/h3-7,20H,9-10,12-13H2,1-2H3/t16-,17+,18-/m1/s1 |
| InChiKey: | InChIKey=GUIXAPOOTIQQDI-FGTMMUONSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.