* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RARECHEM AQ BC 8088 |
English Synonyms: | RARECHEM AQ BC 8088 |
MDL Number.: | MFCD06227562 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | C[C@]12[C@@H](C=C([C@]1([C@@H](C=C2C#N)Br)C)C#N)Br |
InChi: | InChI=1S/C12H10Br2N2/c1-11-7(5-15)3-10(14)12(11,2)8(6-16)4-9(11)13/h3-4,9-10H,1-2H3/t9-,10-,11+,12+/m1/s1 |
InChiKey: | InChIKey=QMFPXNZVIDCFBT-WYUUTHIRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.