* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AQ BC 8088 |
| English Synonyms: | RARECHEM AQ BC 8088 |
| MDL Number.: | MFCD06227562 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | C[C@]12[C@@H](C=C([C@]1([C@@H](C=C2C#N)Br)C)C#N)Br |
| InChi: | InChI=1S/C12H10Br2N2/c1-11-7(5-15)3-10(14)12(11,2)8(6-16)4-9(11)13/h3-4,9-10H,1-2H3/t9-,10-,11+,12+/m1/s1 |
| InChiKey: | InChIKey=QMFPXNZVIDCFBT-WYUUTHIRSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.