* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AQ BC 8114 |
| English Synonyms: | RARECHEM AQ BC 8114 |
| MDL Number.: | MFCD06227575 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | C[C@@]12C=C([C@H]([C@@]1(C(=C(C2(Br)Br)C#N)Br)C)Br)C#N |
| InChi: | InChI=1S/C12H8Br4N2/c1-10-3-6(4-17)8(13)11(10,2)9(14)7(5-18)12(10,15)16/h3,8H,1-2H3/t8-,10-,11-/m1/s1 |
| InChiKey: | InChIKey=OJVMROFOHCTSLT-FBIMIBRVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.