* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AQ BC 8125 |
| English Synonyms: | RARECHEM AQ BC 8125 |
| MDL Number.: | MFCD06227576 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | CC[C@]12C=C([C@@H]([C@]1(C=C([C@@H]2Br)S(=O)(=O)c3ccc(cc3)Cl)C)Br)S(=O)(=O)c4ccc(cc4)Cl |
| InChi: | InChI=1S/C23H20Br2Cl2O4S2/c1-3-23-13-19(33(30,31)17-10-6-15(27)7-11-17)20(24)22(23,2)12-18(21(23)25)32(28,29)16-8-4-14(26)5-9-16/h4-13,20-21H,3H2,1-2H3/t20-,21-,22+,23+/m0/s1 |
| InChiKey: | InChIKey=GBBGNNCYWHQNMX-MYDTUXCISA-N |
* If the product has intellectual property rights, a license granted is must or contact us.