* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AQ BC 9075 |
| English Synonyms: | RARECHEM AQ BC 9075 |
| MDL Number.: | MFCD06227589 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | c1ccc(cc1)S(=O)(=O)C2=C[C@@H]3C[C@H]([C@H]2Br)C=C([C@@H]3Br)S(=O)(=O)c4ccccc4 |
| InChi: | InChI=1S/C21H18Br2O4S2/c22-20-15-11-14(12-18(20)28(24,25)16-7-3-1-4-8-16)21(23)19(13-15)29(26,27)17-9-5-2-6-10-17/h1-10,12-15,20-21H,11H2/t14?,15?,20-,21-/m1/s1 |
| InChiKey: | InChIKey=JIESNCHLHDJXTE-IZVDZAFVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.