* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | RARECHEM AQ BC 9080 |
| English Synonyms: | RARECHEM AQ BC 9080 |
| MDL Number.: | MFCD06227590 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | c1ccc(cc1)[C@@H]2CC(=O)[C@@H]3C[C@@H]2C(=O)C[C@H]3c4ccccc4 |
| InChi: | InChI=1S/C21H20O2/c22-20-12-16(14-7-3-1-4-8-14)18-11-19(20)17(13-21(18)23)15-9-5-2-6-10-15/h1-10,16-19H,11-13H2/t16-,17-,18?,19?/m0/s1 |
| InChiKey: | InChIKey=SXEQPDKWACPHID-YXWAVELNSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.