* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 9-(4-FLUOROPHENYL)[1,3]DIOXOLO[4,5-G]FURO[3,4-B]QUINOLIN-8(6H)-ONE |
| English Synonyms: | 9-(4-FLUOROPHENYL)[1,3]DIOXOLO[4,5-G]FURO[3,4-B]QUINOLIN-8(6H)-ONE |
| MDL Number.: | MFCD06496140 |
| H bond acceptor: | 5 |
| H bond donor: | 0 |
| Smile: | c1cc(ccc1c2c3cc4c(cc3nc5c2C(=O)OC5)OCO4)F |
| InChi: | InChI=1S/C18H10FNO4/c19-10-3-1-9(2-4-10)16-11-5-14-15(24-8-23-14)6-12(11)20-13-7-22-18(21)17(13)16/h1-6H,7-8H2 |
| InChiKey: | InChIKey=ZSULOVSWJZPYCP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.