* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VASICINONE |
| CAS: | 486-64-6 |
| English Synonyms: | VASCINONE ; VASICINONE |
| MDL Number.: | MFCD06656332 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | c1ccc2c(c1)c(=O)n3c(n2)[C@@H](CC3)O |
| InChi: | InChI=1S/C11H10N2O2/c14-9-5-6-13-10(9)12-8-4-2-1-3-7(8)11(13)15/h1-4,9,14H,5-6H2/t9-/m1/s1 |
| InChiKey: | InChIKey=SDIVYZXRQHWCKF-SECBINFHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.