* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | DITHIENO[2,3-B:3',2'-D]THIOPHENE |
| CAS: | 236-63-5 |
| English Synonyms: | DITHIENO[2,3-B:3',2'-D]THIOPHENE ; DITHIEN[2,3-B:3',2'-D]THIOPHENE |
| MDL Number.: | MFCD06656576 |
| H bond acceptor: | 0 |
| H bond donor: | 0 |
| Smile: | c1csc2c1c3ccsc3s2 |
| InChi: | InChI=1S/C8H4S3/c1-3-9-7-5(1)6-2-4-10-8(6)11-7/h1-4H |
| InChiKey: | InChIKey=IAOQICOCWPKKMH-UHFFFAOYSA-N |
|
|
| Comments: | WARNINGS: IRRITANT |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.