* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 5-(3-CHLOROPHENYL)-1,2,4-TRIAZIN-3-AMINE |
CAS: | 886497-14-9 |
English Synonyms: | 5-(3-CHLORO-PHENYL)-[1,2,4]TRIAZIN-3-YLAMINE ; 5-(3-CHLOROPHENYL)-1,2,4-TRIAZIN-3-AMINE |
MDL Number.: | MFCD06739754 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1cc(cc(c1)Cl)c2cnnc(n2)N |
InChi: | InChI=1S/C9H7ClN4/c10-7-3-1-2-6(4-7)8-5-12-14-9(11)13-8/h1-5H,(H2,11,13,14) |
InChiKey: | InChIKey=QDDAICRDPHZNBB-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.