* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-(BROMOMETHYL)-1,8-DIMETHYL-3-OXABICYCLO[3.2.1]OCTANE |
| English Synonyms: | 8-(BROMOMETHYL)-1,8-DIMETHYL-3-OXABICYCLO[3.2.1]OCTANE |
| MDL Number.: | MFCD06740758 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | C[C@@]12CC[C@@H](C1(C)CBr)COC2 |
| InChi: | InChI=1S/C10H17BrO/c1-9-4-3-8(5-12-7-9)10(9,2)6-11/h8H,3-7H2,1-2H3/t8-,9+,10?/m1/s1 |
| InChiKey: | InChIKey=BHVJSNVANTXHSG-ZDGBYWQASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.