* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB025785 |
| English Synonyms: | VITAS-BB TBB025785 |
| MDL Number.: | MFCD06760290 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | NS(=O)(=O)C1=CC=C(CN2C(S)=NC3=C(C=CC=C3)C2=O)C=C1 |
| InChi: | InChI=1S/C15H13N3O3S2/c16-23(20,21)11-7-5-10(6-8-11)9-18-14(19)12-3-1-2-4-13(12)17-15(18)22/h1-8H,9H2,(H,17,22)(H2,16,20,21) |
| InChiKey: | InChIKey=NNBQVHAKJDSYGG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.