* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GIMATECAN |
| CAS: | 292618-32-7 |
| English Synonyms: | GIMATECAN |
| MDL Number.: | MFCD06795143 |
| H bond acceptor: | 8 |
| H bond donor: | 1 |
| Smile: | CC[C@@]1(c2cc-3n(c(=O)c2COC1=O)Cc4c3nc5ccccc5c4/C=N/OC(C)(C)C)O |
| InChi: | InChI=1S/C25H25N3O5/c1-5-25(31)18-10-20-21-16(12-28(20)22(29)17(18)13-32-23(25)30)15(11-26-33-24(2,3)4)14-8-6-7-9-19(14)27-21/h6-11,31H,5,12-13H2,1-4H3/b26-11+/t25-/m0/s1 |
| InChiKey: | InChIKey=UIVFUQKYVFCEKJ-OPTOVBNMSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.